C26H44N3O8P — CID 141145649
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[3-(2,2,4,4-tetramethyl-3-phosphonooxypentan-3-yl)phenyl]carbamate (PubChem CID 141145649) has the molecular formula C26H44N3O8P and a molecular weight of 557.63 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[3-(2,2,4,4-tetramethyl-3-phosphonooxypentan-3-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[3-(2,2,4,4-tetramethyl-3-phosphonooxypentan-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 141145649 |
| Molecular Formula | C26H44N3O8P |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[3-(2,2,4,4-tetramethyl-3-phosphonooxypentan-3-yl)phenyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)c1cccc(C(OP(=O)(O)O)(C(C)(C)C)C(C)(C)C)c1 |
| InChI | InChI=1S/C26H44N3O8P/c1-22(2,3)26(23(4,5)6,37-38(32,33)34)17-14-13-15-18(16-17)29(21(31)36-25(10,11)12)19(27)28-20(30)35-24(7,8)9/h13-16H,1-12H3,(H2,27,28,30)(H2,32,33,34) |
| InChIKey | OMOURELFVZJEDT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 158.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|