C16H28N6O5 — CID 173171610
tert-butyl N-[5-amino-1-(2-hydroxyethyl)pyrazol-4-yl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 173171610) has the molecular formula C16H28N6O5 and a molecular weight of 384.44 g/mol. Its IUPAC name is tert-butyl N-[5-amino-1-(2-hydroxyethyl)pyrazol-4-yl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[5-amino-1-(2-hydroxyethyl)pyrazol-4-yl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 173171610 |
| Molecular Formula | C16H28N6O5 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | tert-butyl N-[5-amino-1-(2-hydroxyethyl)pyrazol-4-yl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)c1cnn(CCO)c1N |
| InChI | InChI=1S/C16H28N6O5/c1-15(2,3)26-13(24)20-12(18)22(14(25)27-16(4,5)6)10-9-19-21(7-8-23)11(10)17/h9,23H,7-8,17H2,1-6H3,(H2,18,20,24) |
| InChIKey | KTMXYKOTHUKTIL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|