C25H44N8O7 — CID 86597895
tert-butyl N-[(4S)-5-[(5-amino-1-methylpyrazol-4-yl)amino]-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-5-oxopentyl]carbamate (PubChem CID 86597895) has the molecular formula C25H44N8O7 and a molecular weight of 568.68 g/mol. Its IUPAC name is tert-butyl N-[(4S)-5-[(5-amino-1-methylpyrazol-4-yl)amino]-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[(4S)-5-[(5-amino-1-methylpyrazol-4-yl)amino]-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 86597895 |
| Molecular Formula | C25H44N8O7 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | tert-butyl N-[(4S)-5-[(5-amino-1-methylpyrazol-4-yl)amino]-4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-5-oxopentyl]carbamate |
| SMILES | Cn1ncc(NC(=O)[C@H](CCCNC(=O)OC(C)(C)C)N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)c1N |
| InChI | InChI=1S/C25H44N8O7/c1-23(2,3)38-20(35)27-13-11-12-15(18(34)29-16-14-28-33(10)17(16)26)30-19(31-21(36)39-24(4,5)6)32-22(37)40-25(7,8)9/h14-15H,11-13,26H2,1-10H3,(H,27,35)(H,29,34)(H2,30,31,32,36,37)/t15-/m0/s1 |
| InChIKey | NFJDKNQOROHUIH-HNNXBMFYSA-N |
| XLogP | 3.02 |
| TPSA | 200.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|