C24H31N3O4 — CID 138974331
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[(E)-3-naphthalen-1-ylprop-2-enyl]carbamate (PubChem CID 138974331) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[(E)-3-naphthalen-1-ylprop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[(E)-3-naphthalen-1-ylprop-2-enyl]carbamate |
|---|---|
| PubChem CID | 138974331 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[(E)-3-naphthalen-1-ylprop-2-enyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(C/C=C/c1cccc2ccccc12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31N3O4/c1-23(2,3)30-21(28)26-20(25)27(22(29)31-24(4,5)6)16-10-14-18-13-9-12-17-11-7-8-15-19(17)18/h7-15H,16H2,1-6H3,(H2,25,26,28)/b14-10+ |
| InChIKey | QODSRGPUQSFRTP-GXDHUFHOSA-N |
| XLogP | 5.55 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|