C28H39N3O7 — CID 140999461
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[3-[3-(phenylmethoxymethyl)phenoxy]propoxy]carbamate (PubChem CID 140999461) has the molecular formula C28H39N3O7 and a molecular weight of 529.63 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[3-[3-(phenylmethoxymethyl)phenoxy]propoxy]carbamate.
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[3-[3-(phenylmethoxymethyl)phenoxy]propoxy]carbamate |
|---|---|
| PubChem CID | 140999461 |
| Molecular Formula | C28H39N3O7 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-N-[3-[3-(phenylmethoxymethyl)phenoxy]propoxy]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(OCCCOc1cccc(COCc2ccccc2)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H39N3O7/c1-27(2,3)37-25(32)30-24(29)31(26(33)38-28(4,5)6)36-17-11-16-35-23-15-10-14-22(18-23)20-34-19-21-12-8-7-9-13-21/h7-10,12-15,18H,11,16-17,19-20H2,1-6H3,(H2,29,30,32) |
| InChIKey | QVCYYRNLMHARIW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|