C26H36N4O5S — CID 91389025
tert-butyl N-[[2-[benzyl(methyl)amino]-5-[carbamoyl(sulfanyl)amino]phenyl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 91389025) has the molecular formula C26H36N4O5S and a molecular weight of 516.66 g/mol. Its IUPAC name is tert-butyl N-[[2-[benzyl(methyl)amino]-5-[carbamoyl(sulfanyl)amino]phenyl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[[2-[benzyl(methyl)amino]-5-[carbamoyl(sulfanyl)amino]phenyl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 91389025 |
| Molecular Formula | C26H36N4O5S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | tert-butyl N-[[2-[benzyl(methyl)amino]-5-[carbamoyl(sulfanyl)amino]phenyl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CN(Cc1ccccc1)c1ccc(N(S)C(N)=O)cc1CN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H36N4O5S/c1-25(2,3)34-23(32)29(24(33)35-26(4,5)6)17-19-15-20(30(36)22(27)31)13-14-21(19)28(7)16-18-11-9-8-10-12-18/h8-15,36H,16-17H2,1-7H3,(H2,27,31) |
| InChIKey | ZBGZIJOOOGQOJT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|