C20H25N3O4S — CID 56975903
tert-butyl N-[[5-[carbamoyl(sulfanyl)amino]-2-phenylmethoxyphenyl]methyl]carbamate (PubChem CID 56975903) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is tert-butyl N-[[5-[carbamoyl(sulfanyl)amino]-2-phenylmethoxyphenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[carbamoyl(sulfanyl)amino]-2-phenylmethoxyphenyl]methyl]carbamate |
|---|---|
| PubChem CID | 56975903 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | tert-butyl N-[[5-[carbamoyl(sulfanyl)amino]-2-phenylmethoxyphenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(N(S)C(N)=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-20(2,3)27-19(25)22-12-15-11-16(23(28)18(21)24)9-10-17(15)26-13-14-7-5-4-6-8-14/h4-11,28H,12-13H2,1-3H3,(H2,21,24)(H,22,25) |
| InChIKey | COJZTGDKFJOQDR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|