C32H41N3O5 — CID 143134687
benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate;N-methyl-N-[(E)-2-(5-methyl-2-phenylmethoxyphenyl)ethylideneamino]methanamine (PubChem CID 143134687) has the molecular formula C32H41N3O5 and a molecular weight of 547.70 g/mol. Its IUPAC name is benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate;N-methyl-N-[(E)-2-(5-methyl-2-phenylmethoxyphenyl)ethylideneamino]methanamine.
| Compound Name | benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate;N-methyl-N-[(E)-2-(5-methyl-2-phenylmethoxyphenyl)ethylideneamino]methanamine |
|---|---|
| PubChem CID | 143134687 |
| Molecular Formula | C32H41N3O5 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.30 |
| IUPAC Name | benzyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate;N-methyl-N-[(E)-2-(5-methyl-2-phenylmethoxyphenyl)ethylideneamino]methanamine |
| SMILES | CC(C)(C)OC(=O)NCC(=O)OCc1ccccc1.Cc1ccc(OCc2ccccc2)c(C/C=N/N(C)C)c1 |
| InChI | InChI=1S/C18H22N2O.C14H19NO4/c1-15-9-10-18(17(13-15)11-12-19-20(2)3)21-14-16-7-5-4-6-8-16;1-14(2,3)19-13(17)15-9-12(16)18-10-11-7-5-4-6-8-11/h4-10,12-13H,11,14H2,1-3H3;4-8H,9-10H2,1-3H3,(H,15,17)/b19-12+; |
| InChIKey | DEEMEWWTFIGOBB-NNTHFVATSA-N |
| XLogP | 5.92 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|