C21H23NO3 — CID 176508099
tert-butyl N-[(3-ethynyl-4-phenylmethoxyphenyl)methyl]carbamate (PubChem CID 176508099) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl N-[(3-ethynyl-4-phenylmethoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(3-ethynyl-4-phenylmethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 176508099 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | tert-butyl N-[(3-ethynyl-4-phenylmethoxyphenyl)methyl]carbamate |
| SMILES | C#Cc1cc(CNC(=O)OC(C)(C)C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C21H23NO3/c1-5-18-13-17(14-22-20(23)25-21(2,3)4)11-12-19(18)24-15-16-9-7-6-8-10-16/h1,6-13H,14-15H2,2-4H3,(H,22,23) |
| InChIKey | UDQGJTYEWVHDRS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|