C21H43N4O7P — CID 177419932
tert-butyl N-[(4R)-4-amino-4-di(propan-2-yloxy)phosphorylbutyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 177419932) has the molecular formula C21H43N4O7P and a molecular weight of 494.57 g/mol. Its IUPAC name is tert-butyl N-[(4R)-4-amino-4-di(propan-2-yloxy)phosphorylbutyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[(4R)-4-amino-4-di(propan-2-yloxy)phosphorylbutyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 177419932 |
| Molecular Formula | C21H43N4O7P |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | tert-butyl N-[(4R)-4-amino-4-di(propan-2-yloxy)phosphorylbutyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(CCC[C@H](N)P(=O)(OC(C)C)OC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H43N4O7P/c1-14(2)31-33(28,32-15(3)4)16(22)12-11-13-25(19(27)30-21(8,9)10)17(23)24-18(26)29-20(5,6)7/h14-16H,11-13,22H2,1-10H3,(H2,23,24,26)/t16-/m1/s1 |
| InChIKey | VIHFMRVECXNIGG-MRXNPFEDSA-N |
| XLogP | 4.79 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|