C10H19N3O3 — CID 152648793
tert-butyl N-carbamimidoyl-N-(4-oxobutyl)carbamate (PubChem CID 152648793) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is tert-butyl N-carbamimidoyl-N-(4-oxobutyl)carbamate.
| Compound Name | tert-butyl N-carbamimidoyl-N-(4-oxobutyl)carbamate |
|---|---|
| PubChem CID | 152648793 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | tert-butyl N-carbamimidoyl-N-(4-oxobutyl)carbamate |
| SMILES | [H]/N=C(\N)N(CCCC=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19N3O3/c1-10(2,3)16-9(15)13(8(11)12)6-4-5-7-14/h7H,4-6H2,1-3H3,(H3,11,12) |
| InChIKey | ZHCQQYYERFLENV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|