C37H74N6O9Si — CID 173372463
tert-butyl N-[7-[[1-[tert-butyl(dimethyl)silyl]oxy-2-[4-(3,3-diethoxypropylamino)butylamino]-2-oxoethyl]amino]-7-oxoheptyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 173372463) has the molecular formula C37H74N6O9Si and a molecular weight of 775.12 g/mol. Its IUPAC name is tert-butyl N-[7-[[1-[tert-butyl(dimethyl)silyl]oxy-2-[4-(3,3-diethoxypropylamino)butylamino]-2-oxoethyl]amino]-7-oxoheptyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[7-[[1-[tert-butyl(dimethyl)silyl]oxy-2-[4-(3,3-diethoxypropylamino)butylamino]-2-oxoethyl]amino]-7-oxoheptyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 173372463 |
| Molecular Formula | C37H74N6O9Si |
| Molecular Weight | 775.12 g/mol |
| Exact Mass | 774.53 |
| IUPAC Name | tert-butyl N-[7-[[1-[tert-butyl(dimethyl)silyl]oxy-2-[4-(3,3-diethoxypropylamino)butylamino]-2-oxoethyl]amino]-7-oxoheptyl]-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)N(CCCCCCC(=O)NC(O[Si](C)(C)C(C)(C)C)C(=O)NCCCCNCCC(OCC)OCC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H74N6O9Si/c1-14-48-29(49-15-2)23-26-39-24-19-20-25-40-30(45)31(52-53(12,13)37(9,10)11)41-28(44)22-18-16-17-21-27-43(34(47)51-36(6,7)8)32(38)42-33(46)50-35(3,4)5/h29,31,39H,14-27H2,1-13H3,(H,40,45)(H,41,44)(H2,38,42,46) |
| InChIKey | HNHNPTZPGTZKMT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 189.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.12 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|