C19H30O5 — CID 168730127
tert-butyl 7-[3,5-bis(hydroxymethyl)phenoxy]heptanoate (PubChem CID 168730127) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is tert-butyl 7-[3,5-bis(hydroxymethyl)phenoxy]heptanoate.
| Compound Name | tert-butyl 7-[3,5-bis(hydroxymethyl)phenoxy]heptanoate |
|---|---|
| PubChem CID | 168730127 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | tert-butyl 7-[3,5-bis(hydroxymethyl)phenoxy]heptanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCOc1cc(CO)cc(CO)c1 |
| InChI | InChI=1S/C19H30O5/c1-19(2,3)24-18(22)8-6-4-5-7-9-23-17-11-15(13-20)10-16(12-17)14-21/h10-12,20-21H,4-9,13-14H2,1-3H3 |
| InChIKey | FYYAZKAMIXQLQD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|