C12H16Cl2 — CID 20672445
1,3-dichloro-5-(4-methylpentyl)benzene (PubChem CID 20672445) has the molecular formula C12H16Cl2 and a molecular weight of 231.17 g/mol. Its IUPAC name is 1,3-dichloro-5-(4-methylpentyl)benzene.
| Compound Name | 1,3-dichloro-5-(4-methylpentyl)benzene |
|---|---|
| PubChem CID | 20672445 |
| Molecular Formula | C12H16Cl2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 1,3-dichloro-5-(4-methylpentyl)benzene |
| SMILES | CC(C)CCCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2/c1-9(2)4-3-5-10-6-11(13)8-12(14)7-10/h6-9H,3-5H2,1-2H3 |
| InChIKey | XIAMLGVPIJFENO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |