C22H28Cl2N2O2 — CID 70963514
tert-butyl N-benzyl-N-[3-(3,4-dichloroanilino)butyl]carbamate (PubChem CID 70963514) has the molecular formula C22H28Cl2N2O2 and a molecular weight of 423.38 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[3-(3,4-dichloroanilino)butyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[3-(3,4-dichloroanilino)butyl]carbamate |
|---|---|
| PubChem CID | 70963514 |
| Molecular Formula | C22H28Cl2N2O2 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | tert-butyl N-benzyl-N-[3-(3,4-dichloroanilino)butyl]carbamate |
| SMILES | CC(CCN(Cc1ccccc1)C(=O)OC(C)(C)C)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H28Cl2N2O2/c1-16(25-18-10-11-19(23)20(24)14-18)12-13-26(21(27)28-22(2,3)4)15-17-8-6-5-7-9-17/h5-11,14,16,25H,12-13,15H2,1-4H3 |
| InChIKey | SIPHVSOKODJQIP-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |