C16H17Cl2N — CID 43110414
3,4-dichloro-N-(4-phenylbutan-2-yl)aniline (PubChem CID 43110414) has the molecular formula C16H17Cl2N and a molecular weight of 294.23 g/mol. Its IUPAC name is 3,4-dichloro-N-(4-phenylbutan-2-yl)aniline.
| Compound Name | 3,4-dichloro-N-(4-phenylbutan-2-yl)aniline |
|---|---|
| PubChem CID | 43110414 |
| Molecular Formula | C16H17Cl2N |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3,4-dichloro-N-(4-phenylbutan-2-yl)aniline |
| SMILES | CC(CCc1ccccc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2N/c1-12(7-8-13-5-3-2-4-6-13)19-14-9-10-15(17)16(18)11-14/h2-6,9-12,19H,7-8H2,1H3 |
| InChIKey | CDIRPDBKXRRTMK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |