C25H34ClNO4 — CID 171066618
tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-(3,3-diethoxypropyl)carbamate (PubChem CID 171066618) has the molecular formula C25H34ClNO4 and a molecular weight of 448.00 g/mol. Its IUPAC name is tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-(3,3-diethoxypropyl)carbamate.
| Compound Name | tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-(3,3-diethoxypropyl)carbamate |
|---|---|
| PubChem CID | 171066618 |
| Molecular Formula | C25H34ClNO4 |
| Molecular Weight | 448.00 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-(3,3-diethoxypropyl)carbamate |
| SMILES | CCOC(CCN(Cc1ccc(-c2ccccc2)c(Cl)c1)C(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C25H34ClNO4/c1-6-29-23(30-7-2)15-16-27(24(28)31-25(3,4)5)18-19-13-14-21(22(26)17-19)20-11-9-8-10-12-20/h8-14,17,23H,6-7,15-16,18H2,1-5H3 |
| InChIKey | LDRAOBRGLBOESF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.00 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|