C37H37ClN4O6 — CID 171066356
6-[3-[3-[(3-chloro-4-phenylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoylamino]propyl]-5-oxobenzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 171066356) has the molecular formula C37H37ClN4O6 and a molecular weight of 669.18 g/mol. Its IUPAC name is 6-[3-[3-[(3-chloro-4-phenylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoylamino]propyl]-5-oxobenzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 6-[3-[3-[(3-chloro-4-phenylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoylamino]propyl]-5-oxobenzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 171066356 |
| Molecular Formula | C37H37ClN4O6 |
| Molecular Weight | 669.18 g/mol |
| Exact Mass | 668.24 |
| IUPAC Name | 6-[3-[3-[(3-chloro-4-phenylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoylamino]propyl]-5-oxobenzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N(CCC(=O)NCCCn1c(=O)c2ccncc2c2ccc(C(=O)O)cc21)Cc1ccc(-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C37H37ClN4O6/c1-37(2,3)48-36(47)41(23-24-10-12-27(31(38)20-24)25-8-5-4-6-9-25)19-15-33(43)40-16-7-18-42-32-21-26(35(45)46)11-13-28(32)30-22-39-17-14-29(30)34(42)44/h4-6,8-14,17,20-22H,7,15-16,18-19,23H2,1-3H3,(H,40,43)(H,45,46) |
| InChIKey | RMBRNGOGOMEHKU-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.18 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|