C39H47ClN6O4 — CID 171066357
tert-butyl N-[[3-chloro-4-[2-(hydroxymethyl)phenyl]phenyl]methyl]-N-[4-[2-[(8-methylbenzo[c][2,6]naphthyridin-5-yl)amino]ethylamino]butyl]carbamate;formamide (PubChem CID 171066357) has the molecular formula C39H47ClN6O4 and a molecular weight of 699.30 g/mol. Its IUPAC name is tert-butyl N-[[3-chloro-4-[2-(hydroxymethyl)phenyl]phenyl]methyl]-N-[4-[2-[(8-methylbenzo[c][2,6]naphthyridin-5-yl)amino]ethylamino]butyl]carbamate;formamide.
| Compound Name | tert-butyl N-[[3-chloro-4-[2-(hydroxymethyl)phenyl]phenyl]methyl]-N-[4-[2-[(8-methylbenzo[c][2,6]naphthyridin-5-yl)amino]ethylamino]butyl]carbamate;formamide |
|---|---|
| PubChem CID | 171066357 |
| Molecular Formula | C39H47ClN6O4 |
| Molecular Weight | 699.30 g/mol |
| Exact Mass | 698.33 |
| IUPAC Name | tert-butyl N-[[3-chloro-4-[2-(hydroxymethyl)phenyl]phenyl]methyl]-N-[4-[2-[(8-methylbenzo[c][2,6]naphthyridin-5-yl)amino]ethylamino]butyl]carbamate;formamide |
| SMILES | Cc1ccc2c(c1)nc(NCCNCCCCN(Cc1ccc(-c3ccccc3CO)c(Cl)c1)C(=O)OC(C)(C)C)c1ccncc12.NC=O |
| InChI | InChI=1S/C38H44ClN5O3.CH3NO/c1-26-11-13-31-33-23-41-17-15-32(33)36(43-35(31)21-26)42-19-18-40-16-7-8-20-44(37(46)47-38(2,3)4)24-27-12-14-30(34(39)22-27)29-10-6-5-9-28(29)25-45;2-1-3/h5-6,9-15,17,21-23,40,45H,7-8,16,18-20,24-25H2,1-4H3,(H,42,43);1H,(H2,2,3) |
| InChIKey | KMPIUOJMOFPHLU-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.30 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|