C31H32ClN7O — CID 171066454
5-[2-[4-[(5-chloro-6-phenyl-3-pyridinyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066454) has the molecular formula C31H32ClN7O and a molecular weight of 554.10 g/mol. Its IUPAC name is 5-[2-[4-[(5-chloro-6-phenyl-3-pyridinyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[(5-chloro-6-phenyl-3-pyridinyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066454 |
| Molecular Formula | C31H32ClN7O |
| Molecular Weight | 554.10 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 5-[2-[4-[(5-chloro-6-phenyl-3-pyridinyl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCNCCCCNCc1cnc(-c3ccccc3)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C31H32ClN7O/c32-27-16-21(19-38-29(27)22-6-2-1-3-7-22)18-35-12-5-4-11-34-14-15-37-31-25-10-13-36-20-26(25)24-9-8-23(30(33)40)17-28(24)39-31/h1-3,6-10,13,16-17,19-20,34-35H,4-5,11-12,14-15,18H2,(H2,33,40)(H,37,39) |
| InChIKey | VPRJWPWWURFKID-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.10 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|