C25H26ClN7O2 — CID 171066050
5-[3-[3-[(5-chloro-3-pyridinyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066050) has the molecular formula C25H26ClN7O2 and a molecular weight of 491.98 g/mol. Its IUPAC name is 5-[3-[3-[(5-chloro-3-pyridinyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[3-[3-[(5-chloro-3-pyridinyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066050 |
| Molecular Formula | C25H26ClN7O2 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 5-[3-[3-[(5-chloro-3-pyridinyl)methylamino]propanoylamino]propylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCCNC(=O)CCNCc1cncc(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C25H26ClN7O2/c26-18-10-16(13-30-14-18)12-28-9-5-23(34)31-6-1-7-32-25-20-4-8-29-15-21(20)19-3-2-17(24(27)35)11-22(19)33-25/h2-4,8,10-11,13-15,28H,1,5-7,9,12H2,(H2,27,35)(H,31,34)(H,32,33) |
| InChIKey | ARBDREXGPBBESG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|