C29H31N7OS — CID 171066521
5-[2-[4-[(5-phenyl-1,3-thiazol-2-yl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066521) has the molecular formula C29H31N7OS and a molecular weight of 525.68 g/mol. Its IUPAC name is 5-[2-[4-[(5-phenyl-1,3-thiazol-2-yl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[(5-phenyl-1,3-thiazol-2-yl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066521 |
| Molecular Formula | C29H31N7OS |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 5-[2-[4-[(5-phenyl-1,3-thiazol-2-yl)methylamino]butylamino]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCNCCCCNCc1ncc(-c3ccccc3)s1)c1ccncc12 |
| InChI | InChI=1S/C29H31N7OS/c30-28(37)21-8-9-22-24-17-33-13-10-23(24)29(36-25(22)16-21)34-15-14-31-11-4-5-12-32-19-27-35-18-26(38-27)20-6-2-1-3-7-20/h1-3,6-10,13,16-18,31-32H,4-5,11-12,14-15,19H2,(H2,30,37)(H,34,36) |
| InChIKey | WTEXMPZOWGHUTE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|