C27H30ClN5O2 — CID 171066325
5-[2-[(4S)-4-[(3-chlorophenyl)methylamino]pentoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066325) has the molecular formula C27H30ClN5O2 and a molecular weight of 492.02 g/mol. Its IUPAC name is 5-[2-[(4S)-4-[(3-chlorophenyl)methylamino]pentoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[(4S)-4-[(3-chlorophenyl)methylamino]pentoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066325 |
| Molecular Formula | C27H30ClN5O2 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 5-[2-[(4S)-4-[(3-chlorophenyl)methylamino]pentoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | C[C@@H](CCCOCCNc1nc2cc(C(N)=O)ccc2c2cnccc12)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C27H30ClN5O2/c1-18(32-16-19-5-2-6-21(28)14-19)4-3-12-35-13-11-31-27-23-9-10-30-17-24(23)22-8-7-20(26(29)34)15-25(22)33-27/h2,5-10,14-15,17-18,32H,3-4,11-13,16H2,1H3,(H2,29,34)(H,31,33)/t18-/m0/s1 |
| InChIKey | BKDNBSAQXZBPSN-SFHVURJKSA-N |
| XLogP | 4.92 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|