C24H24N4O2 — CID 171066233
methyl 5-[2-[3-(2-aminoethyl)phenyl]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylate (PubChem CID 171066233) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is methyl 5-[2-[3-(2-aminoethyl)phenyl]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylate.
| Compound Name | methyl 5-[2-[3-(2-aminoethyl)phenyl]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 171066233 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | methyl 5-[2-[3-(2-aminoethyl)phenyl]ethylamino]benzo[c][2,6]naphthyridine-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(NCCc1cccc(CCN)c1)c1ccncc12 |
| InChI | InChI=1S/C24H24N4O2/c1-30-24(29)18-5-6-19-21-15-26-11-9-20(21)23(28-22(19)14-18)27-12-8-17-4-2-3-16(13-17)7-10-25/h2-6,9,11,13-15H,7-8,10,12,25H2,1H3,(H,27,28) |
| InChIKey | NTVIWMGTACWCOR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|