C19H22N6O2 — CID 171066209
5-[3-(3-aminopropanoylamino)propylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066209) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 5-[3-(3-aminopropanoylamino)propylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[3-(3-aminopropanoylamino)propylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066209 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 5-[3-(3-aminopropanoylamino)propylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NCCC(=O)NCCCNc1nc2cc(C(N)=O)ccc2c2cnccc12 |
| InChI | InChI=1S/C19H22N6O2/c20-6-4-17(26)23-7-1-8-24-19-14-5-9-22-11-15(14)13-3-2-12(18(21)27)10-16(13)25-19/h2-3,5,9-11H,1,4,6-8,20H2,(H2,21,27)(H,23,26)(H,24,25) |
| InChIKey | WGRBYXGCEZSGRX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|