C27H26ClF3N6O3 — CID 171066189
5-[[4-[2-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]ethylamino]-4-oxobutyl]amino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 171066189) has the molecular formula C27H26ClF3N6O3 and a molecular weight of 574.99 g/mol. Its IUPAC name is 5-[[4-[2-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]ethylamino]-4-oxobutyl]amino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[[4-[2-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]ethylamino]-4-oxobutyl]amino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 171066189 |
| Molecular Formula | C27H26ClF3N6O3 |
| Molecular Weight | 574.99 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 5-[[4-[2-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]ethylamino]-4-oxobutyl]amino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCCC(=O)NCCNCc1ccc(OC(F)(F)F)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C27H26ClF3N6O3/c28-21-12-16(3-6-23(21)40-27(29,30)31)14-34-10-11-35-24(38)2-1-8-36-26-19-7-9-33-15-20(19)18-5-4-17(25(32)39)13-22(18)37-26/h3-7,9,12-13,15,34H,1-2,8,10-11,14H2,(H2,32,39)(H,35,38)(H,36,37) |
| InChIKey | YOLWIHZJLYOOGN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.99 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|