C29H31ClF3N5O3 — CID 164915294
5-[[1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]-2-methylpropan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915294) has the molecular formula C29H31ClF3N5O3 and a molecular weight of 590.05 g/mol. Its IUPAC name is 5-[[1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]-2-methylpropan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[[1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]-2-methylpropan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915294 |
| Molecular Formula | C29H31ClF3N5O3 |
| Molecular Weight | 590.05 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | 5-[[1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]-2-methylpropan-2-yl]amino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | CC(C)(COCCCCNCc1ccc(OC(F)(F)F)c(Cl)c1)Nc1nc2cc(C(N)=O)ccc2c2cnccc12 |
| InChI | InChI=1S/C29H31ClF3N5O3/c1-28(2,17-40-12-4-3-10-35-15-18-5-8-25(23(30)13-18)41-29(31,32)33)38-27-21-9-11-36-16-22(21)20-7-6-19(26(34)39)14-24(20)37-27/h5-9,11,13-14,16,35H,3-4,10,12,15,17H2,1-2H3,(H2,34,39)(H,37,38) |
| InChIKey | HBMHNAPZOMEESB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.05 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|