C27H26ClF3N8O2 — CID 171065946
N-[2-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethyl]-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine (PubChem CID 171065946) has the molecular formula C27H26ClF3N8O2 and a molecular weight of 587.01 g/mol. Its IUPAC name is N-[2-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethyl]-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine.
| Compound Name | N-[2-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethyl]-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine |
|---|---|
| PubChem CID | 171065946 |
| Molecular Formula | C27H26ClF3N8O2 |
| Molecular Weight | 587.01 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | N-[2-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethyl]-8-(2H-tetrazol-5-yl)benzo[c][2,6]naphthyridin-5-amine |
| SMILES | FC(F)(F)Oc1ccc(CNCCCCOCCNc2nc3cc(-c4nn[nH]n4)ccc3c3cnccc23)cc1Cl |
| InChI | InChI=1S/C27H26ClF3N8O2/c28-22-13-17(3-6-24(22)41-27(29,30)31)15-32-8-1-2-11-40-12-10-34-26-20-7-9-33-16-21(20)19-5-4-18(14-23(19)35-26)25-36-38-39-37-25/h3-7,9,13-14,16,32H,1-2,8,10-12,15H2,(H,34,35)(H,36,37,38,39) |
| InChIKey | MABJWVMAAIFKME-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.01 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|