C14H19ClF3NO3 — CID 171065908
2-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethanol (PubChem CID 171065908) has the molecular formula C14H19ClF3NO3 and a molecular weight of 341.76 g/mol. Its IUPAC name is 2-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethanol.
| Compound Name | 2-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethanol |
|---|---|
| PubChem CID | 171065908 |
| Molecular Formula | C14H19ClF3NO3 |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]ethanol |
| SMILES | OCCOCCCCNCc1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClF3NO3/c15-12-9-11(3-4-13(12)22-14(16,17)18)10-19-5-1-2-7-21-8-6-20/h3-4,9,19-20H,1-2,5-8,10H2 |
| InChIKey | SSHOGZXSHSNFPY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|