C29H29ClF3N3O5 — CID 175503636
methyl 5-[1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yloxy]benzo[c][2,6]naphthyridine-8-carboxylate (PubChem CID 175503636) has the molecular formula C29H29ClF3N3O5 and a molecular weight of 592.01 g/mol. Its IUPAC name is methyl 5-[1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yloxy]benzo[c][2,6]naphthyridine-8-carboxylate.
| Compound Name | methyl 5-[1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yloxy]benzo[c][2,6]naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 175503636 |
| Molecular Formula | C29H29ClF3N3O5 |
| Molecular Weight | 592.01 g/mol |
| Exact Mass | 591.17 |
| IUPAC Name | methyl 5-[1-[4-[[3-chloro-4-(trifluoromethoxy)phenyl]methylamino]butoxy]propan-2-yloxy]benzo[c][2,6]naphthyridine-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(OC(C)COCCCCNCc1ccc(OC(F)(F)F)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C29H29ClF3N3O5/c1-18(17-39-12-4-3-10-34-15-19-5-8-26(24(30)13-19)41-29(31,32)33)40-27-22-9-11-35-16-23(22)21-7-6-20(28(37)38-2)14-25(21)36-27/h5-9,11,13-14,16,18,34H,3-4,10,12,15,17H2,1-2H3 |
| InChIKey | CVAPKJFHFNAYNX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.01 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|