C14H9ClN2O2 — CID 25252836
methyl 5-chlorobenzo[c][2,6]naphthyridine-8-carboxylate (PubChem CID 25252836) has the molecular formula C14H9ClN2O2 and a molecular weight of 272.69 g/mol. Its IUPAC name is methyl 5-chlorobenzo[c][2,6]naphthyridine-8-carboxylate.
| Compound Name | methyl 5-chlorobenzo[c][2,6]naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 25252836 |
| Molecular Formula | C14H9ClN2O2 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | methyl 5-chlorobenzo[c][2,6]naphthyridine-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(Cl)c1ccncc12 |
| InChI | InChI=1S/C14H9ClN2O2/c1-19-14(18)8-2-3-9-11-7-16-5-4-10(11)13(15)17-12(9)6-8/h2-7H,1H3 |
| InChIKey | XCRKEOCRHSQXHV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|