C28H26F5N3O5 — CID 171066589
5-[2-[(4S)-4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]pentoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 171066589) has the molecular formula C28H26F5N3O5 and a molecular weight of 579.52 g/mol. Its IUPAC name is 5-[2-[(4S)-4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]pentoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 5-[2-[(4S)-4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]pentoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 171066589 |
| Molecular Formula | C28H26F5N3O5 |
| Molecular Weight | 579.52 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | 5-[2-[(4S)-4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methylamino]pentoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | C[C@@H](CCCOCCOc1nc2cc(C(=O)O)ccc2c2cnccc12)NCc1cc(F)c(OC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C28H26F5N3O5/c1-16(35-14-17-11-22(29)25(23(30)12-17)41-28(31,32)33)3-2-8-39-9-10-40-26-20-6-7-34-15-21(20)19-5-4-18(27(37)38)13-24(19)36-26/h4-7,11-13,15-16,35H,2-3,8-10,14H2,1H3,(H,37,38)/t16-/m0/s1 |
| InChIKey | YYDDKIXKKVBLQS-INIZCTEOSA-N |
| XLogP | 6.01 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|