C27H23F5N5O3+ — CID 171065954
4-[2-[8-(2-aza-1-azoniacyclopropa-1,3-dien-3-yl)benzo[c][2,6]naphthyridin-5-yl]oxyethoxy]-N-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methyl]butan-1-amine (PubChem CID 171065954) has the molecular formula C27H23F5N5O3+ and a molecular weight of 560.50 g/mol. Its IUPAC name is 4-[2-[8-(2-aza-1-azoniacyclopropa-1,3-dien-3-yl)benzo[c][2,6]naphthyridin-5-yl]oxyethoxy]-N-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methyl]butan-1-amine.
| Compound Name | 4-[2-[8-(2-aza-1-azoniacyclopropa-1,3-dien-3-yl)benzo[c][2,6]naphthyridin-5-yl]oxyethoxy]-N-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 171065954 |
| Molecular Formula | C27H23F5N5O3+ |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 4-[2-[8-(2-aza-1-azoniacyclopropa-1,3-dien-3-yl)benzo[c][2,6]naphthyridin-5-yl]oxyethoxy]-N-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methyl]butan-1-amine |
| SMILES | Fc1cc(CNCCCCOCCOc2nc3cc(C4=[N+]=N4)ccc3c3cnccc23)cc(F)c1OC(F)(F)F |
| InChI | InChI=1S/C27H23F5N5O3/c28-21-11-16(12-22(29)24(21)40-27(30,31)32)14-33-6-1-2-8-38-9-10-39-26-19-5-7-34-15-20(19)18-4-3-17(25-36-37-25)13-23(18)35-26/h3-5,7,11-13,15,33H,1-2,6,8-10,14H2/q+1 |
| InChIKey | GSFXLOWGVFULHI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 91.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|