C19H22N4O3 — CID 164915016
5-[2-(4-aminobutoxy)ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 164915016) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-[2-(4-aminobutoxy)ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-(4-aminobutoxy)ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 164915016 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 5-[2-(4-aminobutoxy)ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NCCCCOCCOc1nc2cc(C(N)=O)ccc2c2cnccc12 |
| InChI | InChI=1S/C19H22N4O3/c20-6-1-2-8-25-9-10-26-19-15-5-7-22-12-16(15)14-4-3-13(18(21)24)11-17(14)23-19/h3-5,7,11-12H,1-2,6,8-10,20H2,(H2,21,24) |
| InChIKey | NJPZCZLICWDPJS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|