C34H36F5N3O8 — CID 174282887
methoxymethyl 5-[2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylate (PubChem CID 174282887) has the molecular formula C34H36F5N3O8 and a molecular weight of 709.67 g/mol. Its IUPAC name is methoxymethyl 5-[2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylate.
| Compound Name | methoxymethyl 5-[2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 174282887 |
| Molecular Formula | C34H36F5N3O8 |
| Molecular Weight | 709.67 g/mol |
| Exact Mass | 709.24 |
| IUPAC Name | methoxymethyl 5-[2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxylate |
| SMILES | COCOC(=O)c1ccc2c(c1)nc(OCCOCCCCN(Cc1cc(F)c(OC(F)(F)F)c(F)c1)C(=O)OC(C)(C)C)c1ccncc12 |
| InChI | InChI=1S/C34H36F5N3O8/c1-33(2,3)50-32(44)42(19-21-15-26(35)29(27(36)16-21)49-34(37,38)39)11-5-6-12-46-13-14-47-30-24-9-10-40-18-25(24)23-8-7-22(17-28(23)41-30)31(43)48-20-45-4/h7-10,15-18H,5-6,11-14,19-20H2,1-4H3 |
| InChIKey | FZTSRPBQUYABTN-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 118.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.67 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|