C29H34F5IN7O4P — CID 171067780
tert-butyl N-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methyl]-N-[4-[2-[[1-iodophosphanyl-6-(1,2,4-triazol-4-yl)indazol-4-yl]methylamino]ethoxy]butyl]carbamate (PubChem CID 171067780) has the molecular formula C29H34F5IN7O4P and a molecular weight of 797.50 g/mol. Its IUPAC name is tert-butyl N-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methyl]-N-[4-[2-[[1-iodophosphanyl-6-(1,2,4-triazol-4-yl)indazol-4-yl]methylamino]ethoxy]butyl]carbamate.
| Compound Name | tert-butyl N-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methyl]-N-[4-[2-[[1-iodophosphanyl-6-(1,2,4-triazol-4-yl)indazol-4-yl]methylamino]ethoxy]butyl]carbamate |
|---|---|
| PubChem CID | 171067780 |
| Molecular Formula | C29H34F5IN7O4P |
| Molecular Weight | 797.50 g/mol |
| Exact Mass | 797.14 |
| IUPAC Name | tert-butyl N-[[3,5-difluoro-4-(trifluoromethoxy)phenyl]methyl]-N-[4-[2-[[1-iodophosphanyl-6-(1,2,4-triazol-4-yl)indazol-4-yl]methylamino]ethoxy]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCCCOCCNCc1cc(-n2cnnc2)cc2c1cnn2PI)Cc1cc(F)c(OC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C29H34F5IN7O4P/c1-28(2,3)46-27(43)40(16-19-10-23(30)26(24(31)11-19)45-29(32,33)34)7-4-5-8-44-9-6-36-14-20-12-21(41-17-37-38-18-41)13-25-22(20)15-39-42(25)47-35/h10-13,15,17-18,36,47H,4-9,14,16H2,1-3H3 |
| InChIKey | FVIBGZRXTOZSBU-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.50 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|