C20H30IN4O5P — CID 171067700
methyl 1-iodophosphanyl-4-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]ethylamino]indazole-6-carboxylate (PubChem CID 171067700) has the molecular formula C20H30IN4O5P and a molecular weight of 564.36 g/mol. Its IUPAC name is methyl 1-iodophosphanyl-4-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]ethylamino]indazole-6-carboxylate.
| Compound Name | methyl 1-iodophosphanyl-4-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]ethylamino]indazole-6-carboxylate |
|---|---|
| PubChem CID | 171067700 |
| Molecular Formula | C20H30IN4O5P |
| Molecular Weight | 564.36 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | methyl 1-iodophosphanyl-4-[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]ethylamino]indazole-6-carboxylate |
| SMILES | COC(=O)c1cc(NCCOCCCCNC(=O)OC(C)(C)C)c2cnn(PI)c2c1 |
| InChI | InChI=1S/C20H30IN4O5P/c1-20(2,3)30-19(27)23-7-5-6-9-29-10-8-22-16-11-14(18(26)28-4)12-17-15(16)13-24-25(17)31-21/h11-13,22,31H,5-10H2,1-4H3,(H,23,27) |
| InChIKey | JCBPTHGYPVTXJW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|