C16H21IN5O3P — CID 171067097
tert-butyl N-[6-(dimethylaminomethylidenecarbamoyl)-1-iodophosphanylindazol-4-yl]carbamate (PubChem CID 171067097) has the molecular formula C16H21IN5O3P and a molecular weight of 489.25 g/mol. Its IUPAC name is tert-butyl N-[6-(dimethylaminomethylidenecarbamoyl)-1-iodophosphanylindazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[6-(dimethylaminomethylidenecarbamoyl)-1-iodophosphanylindazol-4-yl]carbamate |
|---|---|
| PubChem CID | 171067097 |
| Molecular Formula | C16H21IN5O3P |
| Molecular Weight | 489.25 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | tert-butyl N-[6-(dimethylaminomethylidenecarbamoyl)-1-iodophosphanylindazol-4-yl]carbamate |
| SMILES | CN(C)/C=N/C(=O)c1cc(NC(=O)OC(C)(C)C)c2cnn(PI)c2c1 |
| InChI | InChI=1S/C16H21IN5O3P/c1-16(2,3)25-15(24)20-12-6-10(14(23)18-9-21(4)5)7-13-11(12)8-19-22(13)26-17/h6-9,26H,1-5H3,(H,20,24)/b18-9+ |
| InChIKey | IPOIFDFFKJVYTH-GIJQJNRQSA-N |
| XLogP | 3.90 |
| TPSA | 88.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.25 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|