C34H41ClIN6O4P — CID 171067756
tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-[3-[3-[[6-(dimethylcarbamoyl)-1-iodophosphanylindazol-4-yl]amino]propylamino]-3-oxopropyl]carbamate (PubChem CID 171067756) has the molecular formula C34H41ClIN6O4P and a molecular weight of 791.07 g/mol. Its IUPAC name is tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-[3-[3-[[6-(dimethylcarbamoyl)-1-iodophosphanylindazol-4-yl]amino]propylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-[3-[3-[[6-(dimethylcarbamoyl)-1-iodophosphanylindazol-4-yl]amino]propylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 171067756 |
| Molecular Formula | C34H41ClIN6O4P |
| Molecular Weight | 791.07 g/mol |
| Exact Mass | 790.17 |
| IUPAC Name | tert-butyl N-[(3-chloro-4-phenylphenyl)methyl]-N-[3-[3-[[6-(dimethylcarbamoyl)-1-iodophosphanylindazol-4-yl]amino]propylamino]-3-oxopropyl]carbamate |
| SMILES | CN(C)C(=O)c1cc(NCCCNC(=O)CCN(Cc2ccc(-c3ccccc3)c(Cl)c2)C(=O)OC(C)(C)C)c2cnn(PI)c2c1 |
| InChI | InChI=1S/C34H41ClIN6O4P/c1-34(2,3)46-33(45)41(22-23-12-13-26(28(35)18-23)24-10-7-6-8-11-24)17-14-31(43)38-16-9-15-37-29-19-25(32(44)40(4)5)20-30-27(29)21-39-42(30)47-36/h6-8,10-13,18-21,37,47H,9,14-17,22H2,1-5H3,(H,38,43) |
| InChIKey | LWFDQTRCFHCOSA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.07 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|