C33H36ClN5O — CID 171067663
3-[(3-chloro-4-phenylphenyl)methylamino]-N-[3-[2-ethenyl-3-(methylamino)-5-pyridin-4-ylanilino]propyl]propanamide (PubChem CID 171067663) has the molecular formula C33H36ClN5O and a molecular weight of 554.14 g/mol. Its IUPAC name is 3-[(3-chloro-4-phenylphenyl)methylamino]-N-[3-[2-ethenyl-3-(methylamino)-5-pyridin-4-ylanilino]propyl]propanamide.
| Compound Name | 3-[(3-chloro-4-phenylphenyl)methylamino]-N-[3-[2-ethenyl-3-(methylamino)-5-pyridin-4-ylanilino]propyl]propanamide |
|---|---|
| PubChem CID | 171067663 |
| Molecular Formula | C33H36ClN5O |
| Molecular Weight | 554.14 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 3-[(3-chloro-4-phenylphenyl)methylamino]-N-[3-[2-ethenyl-3-(methylamino)-5-pyridin-4-ylanilino]propyl]propanamide |
| SMILES | C=Cc1c(NC)cc(-c2ccncc2)cc1NCCCNC(=O)CCNCc1ccc(-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C33H36ClN5O/c1-3-28-31(35-2)21-27(25-12-17-36-18-13-25)22-32(28)38-15-7-16-39-33(40)14-19-37-23-24-10-11-29(30(34)20-24)26-8-5-4-6-9-26/h3-6,8-13,17-18,20-22,35,37-38H,1,7,14-16,19,23H2,2H3,(H,39,40) |
| InChIKey | ICXZYXKUUNEGBX-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.14 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|