C32H40ClN3O6S2 — CID 172849143
3-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methylamino]-N-[(2R)-3-phenyl-2-sulfanylpropyl]propanamide;pentanoic acid (PubChem CID 172849143) has the molecular formula C32H40ClN3O6S2 and a molecular weight of 662.27 g/mol. Its IUPAC name is 3-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methylamino]-N-[(2R)-3-phenyl-2-sulfanylpropyl]propanamide;pentanoic acid.
| Compound Name | 3-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methylamino]-N-[(2R)-3-phenyl-2-sulfanylpropyl]propanamide;pentanoic acid |
|---|---|
| PubChem CID | 172849143 |
| Molecular Formula | C32H40ClN3O6S2 |
| Molecular Weight | 662.27 g/mol |
| Exact Mass | 661.20 |
| IUPAC Name | 3-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methylamino]-N-[(2R)-3-phenyl-2-sulfanylpropyl]propanamide;pentanoic acid |
| SMILES | CC(=O)NS(=O)(=O)c1ccccc1-c1ccc(CNCCC(=O)NC[C@H](S)Cc2ccccc2)cc1Cl.CCCCC(=O)O |
| InChI | InChI=1S/C27H30ClN3O4S2.C5H10O2/c1-19(32)31-37(34,35)26-10-6-5-9-24(26)23-12-11-21(16-25(23)28)17-29-14-13-27(33)30-18-22(36)15-20-7-3-2-4-8-20;1-2-3-4-5(6)7/h2-12,16,22,29,36H,13-15,17-18H2,1H3,(H,30,33)(H,31,32);2-4H2,1H3,(H,6,7)/t22-;/m1./s1 |
| InChIKey | XVFZGCBVTIVTBR-VZYDHVRKSA-N |
| XLogP | 5.23 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.27 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|