C32H38ClN3O5S2 — CID 90720501
N-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methyl]-N-[3-oxo-3-[[(2R)-3-phenyl-2-sulfanylpropyl]amino]propyl]pentanamide (PubChem CID 90720501) has the molecular formula C32H38ClN3O5S2 and a molecular weight of 644.26 g/mol. Its IUPAC name is N-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methyl]-N-[3-oxo-3-[[(2R)-3-phenyl-2-sulfanylpropyl]amino]propyl]pentanamide.
| Compound Name | N-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methyl]-N-[3-oxo-3-[[(2R)-3-phenyl-2-sulfanylpropyl]amino]propyl]pentanamide |
|---|---|
| PubChem CID | 90720501 |
| Molecular Formula | C32H38ClN3O5S2 |
| Molecular Weight | 644.26 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | N-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methyl]-N-[3-oxo-3-[[(2R)-3-phenyl-2-sulfanylpropyl]amino]propyl]pentanamide |
| SMILES | CCCCC(=O)N(CCC(=O)NC[C@H](S)Cc1ccccc1)Cc1ccc(-c2ccccc2S(=O)(=O)NC(C)=O)c(Cl)c1 |
| InChI | InChI=1S/C32H38ClN3O5S2/c1-3-4-14-32(39)36(18-17-31(38)34-21-26(42)19-24-10-6-5-7-11-24)22-25-15-16-27(29(33)20-25)28-12-8-9-13-30(28)43(40,41)35-23(2)37/h5-13,15-16,20,26,42H,3-4,14,17-19,21-22H2,1-2H3,(H,34,38)(H,35,37)/t26-/m1/s1 |
| InChIKey | RTUADAGPNXKGND-AREMUKBSSA-N |
| XLogP | 5.40 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.26 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|