C30H40ClN3O5S2 — CID 87165903
N-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methyl]-N-[2-[[(2S)-2-cyclohexyl-3-sulfanylpropanoyl]amino]ethyl]butanamide (PubChem CID 87165903) has the molecular formula C30H40ClN3O5S2 and a molecular weight of 622.25 g/mol. Its IUPAC name is N-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methyl]-N-[2-[[(2S)-2-cyclohexyl-3-sulfanylpropanoyl]amino]ethyl]butanamide.
| Compound Name | N-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methyl]-N-[2-[[(2S)-2-cyclohexyl-3-sulfanylpropanoyl]amino]ethyl]butanamide |
|---|---|
| PubChem CID | 87165903 |
| Molecular Formula | C30H40ClN3O5S2 |
| Molecular Weight | 622.25 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | N-[[4-[2-(acetylsulfamoyl)phenyl]-3-chlorophenyl]methyl]-N-[2-[[(2S)-2-cyclohexyl-3-sulfanylpropanoyl]amino]ethyl]butanamide |
| SMILES | CCCC(=O)N(CCNC(=O)[C@@H](CS)C1CCCCC1)Cc1ccc(-c2ccccc2S(=O)(=O)NC(C)=O)c(Cl)c1 |
| InChI | InChI=1S/C30H40ClN3O5S2/c1-3-9-29(36)34(17-16-32-30(37)26(20-40)23-10-5-4-6-11-23)19-22-14-15-24(27(31)18-22)25-12-7-8-13-28(25)41(38,39)33-21(2)35/h7-8,12-15,18,23,26,40H,3-6,9-11,16-17,19-20H2,1-2H3,(H,32,37)(H,33,35)/t26-/m0/s1 |
| InChIKey | KGNJXMAVBDVSCQ-SANMLTNESA-N |
| XLogP | 5.20 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|