C33H42ClN3O7S2 — CID 172734153
(2S)-2-benzyl-N-[2-[[3-chloro-4-[2-[[(2S)-2-hydroxypropanoyl]sulfamoyl]phenyl]phenyl]methylamino]ethyl]-3-sulfanylpropanamide;pentanoic acid (PubChem CID 172734153) has the molecular formula C33H42ClN3O7S2 and a molecular weight of 692.30 g/mol. Its IUPAC name is (2S)-2-benzyl-N-[2-[[3-chloro-4-[2-[[(2S)-2-hydroxypropanoyl]sulfamoyl]phenyl]phenyl]methylamino]ethyl]-3-sulfanylpropanamide;pentanoic acid.
| Compound Name | (2S)-2-benzyl-N-[2-[[3-chloro-4-[2-[[(2S)-2-hydroxypropanoyl]sulfamoyl]phenyl]phenyl]methylamino]ethyl]-3-sulfanylpropanamide;pentanoic acid |
|---|---|
| PubChem CID | 172734153 |
| Molecular Formula | C33H42ClN3O7S2 |
| Molecular Weight | 692.30 g/mol |
| Exact Mass | 691.22 |
| IUPAC Name | (2S)-2-benzyl-N-[2-[[3-chloro-4-[2-[[(2S)-2-hydroxypropanoyl]sulfamoyl]phenyl]phenyl]methylamino]ethyl]-3-sulfanylpropanamide;pentanoic acid |
| SMILES | CCCCC(=O)O.C[C@H](O)C(=O)NS(=O)(=O)c1ccccc1-c1ccc(CNCCNC(=O)[C@@H](CS)Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C28H32ClN3O5S2.C5H10O2/c1-19(33)27(34)32-39(36,37)26-10-6-5-9-24(26)23-12-11-21(16-25(23)29)17-30-13-14-31-28(35)22(18-38)15-20-7-3-2-4-8-20;1-2-3-4-5(6)7/h2-12,16,19,22,30,33,38H,13-15,17-18H2,1H3,(H,31,35)(H,32,34);2-4H2,1H3,(H,6,7)/t19-,22+;/m0./s1 |
| InChIKey | IEVWJCPSOAYJEY-MGBOEYOKSA-N |
| XLogP | 4.45 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|