C31H31ClN6O — CID 171067732
3-[(3-chloro-4-phenylphenyl)methylamino]-N-[3-[(6-pyridin-4-yl-1H-indazol-4-yl)amino]propyl]propanamide (PubChem CID 171067732) has the molecular formula C31H31ClN6O and a molecular weight of 539.08 g/mol. Its IUPAC name is 3-[(3-chloro-4-phenylphenyl)methylamino]-N-[3-[(6-pyridin-4-yl-1H-indazol-4-yl)amino]propyl]propanamide.
| Compound Name | 3-[(3-chloro-4-phenylphenyl)methylamino]-N-[3-[(6-pyridin-4-yl-1H-indazol-4-yl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 171067732 |
| Molecular Formula | C31H31ClN6O |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 3-[(3-chloro-4-phenylphenyl)methylamino]-N-[3-[(6-pyridin-4-yl-1H-indazol-4-yl)amino]propyl]propanamide |
| SMILES | O=C(CCNCc1ccc(-c2ccccc2)c(Cl)c1)NCCCNc1cc(-c2ccncc2)cc2[nH]ncc12 |
| InChI | InChI=1S/C31H31ClN6O/c32-28-17-22(7-8-26(28)24-5-2-1-3-6-24)20-34-16-11-31(39)36-13-4-12-35-29-18-25(23-9-14-33-15-10-23)19-30-27(29)21-37-38-30/h1-3,5-10,14-15,17-19,21,34-35H,4,11-13,16,20H2,(H,36,39)(H,37,38) |
| InChIKey | PNRIETCBBUGHSE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|