C32H29ClN4O4 — CID 171066026
6-[3-[3-[(3-chloro-4-phenylphenyl)methylamino]propanoylamino]propyl]-5-oxobenzo[c][2,6]naphthyridine-8-carboxylic acid (PubChem CID 171066026) has the molecular formula C32H29ClN4O4 and a molecular weight of 569.06 g/mol. Its IUPAC name is 6-[3-[3-[(3-chloro-4-phenylphenyl)methylamino]propanoylamino]propyl]-5-oxobenzo[c][2,6]naphthyridine-8-carboxylic acid.
| Compound Name | 6-[3-[3-[(3-chloro-4-phenylphenyl)methylamino]propanoylamino]propyl]-5-oxobenzo[c][2,6]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 171066026 |
| Molecular Formula | C32H29ClN4O4 |
| Molecular Weight | 569.06 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 6-[3-[3-[(3-chloro-4-phenylphenyl)methylamino]propanoylamino]propyl]-5-oxobenzo[c][2,6]naphthyridine-8-carboxylic acid |
| SMILES | O=C(CCNCc1ccc(-c2ccccc2)c(Cl)c1)NCCCn1c(=O)c2ccncc2c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C32H29ClN4O4/c33-28-17-21(7-9-24(28)22-5-2-1-3-6-22)19-34-15-12-30(38)36-13-4-16-37-29-18-23(32(40)41)8-10-25(29)27-20-35-14-11-26(27)31(37)39/h1-3,5-11,14,17-18,20,34H,4,12-13,15-16,19H2,(H,36,38)(H,40,41) |
| InChIKey | ZMYMTCKUZSBHJM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.06 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|