C14H21Cl3N2O — CID 119432244
4-(3,4-dichlorophenyl)-N-[3-(methylamino)propyl]butanamide;hydrochloride (PubChem CID 119432244) has the molecular formula C14H21Cl3N2O and a molecular weight of 339.69 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-[3-(methylamino)propyl]butanamide;hydrochloride.
| Compound Name | 4-(3,4-dichlorophenyl)-N-[3-(methylamino)propyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119432244 |
| Molecular Formula | C14H21Cl3N2O |
| Molecular Weight | 339.69 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-[3-(methylamino)propyl]butanamide;hydrochloride |
| SMILES | CNCCCNC(=O)CCCc1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C14H20Cl2N2O.ClH/c1-17-8-3-9-18-14(19)5-2-4-11-6-7-12(15)13(16)10-11;/h6-7,10,17H,2-5,8-9H2,1H3,(H,18,19);1H |
| InChIKey | XYLSOJGFOIHBPO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|