C38H39ClN4O6 — CID 171066249
methyl 6-[3-[3-[(3-chloro-4-phenylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoylamino]propyl]-5-oxobenzo[c][2,6]naphthyridine-8-carboxylate (PubChem CID 171066249) has the molecular formula C38H39ClN4O6 and a molecular weight of 683.21 g/mol. Its IUPAC name is methyl 6-[3-[3-[(3-chloro-4-phenylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoylamino]propyl]-5-oxobenzo[c][2,6]naphthyridine-8-carboxylate.
| Compound Name | methyl 6-[3-[3-[(3-chloro-4-phenylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoylamino]propyl]-5-oxobenzo[c][2,6]naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 171066249 |
| Molecular Formula | C38H39ClN4O6 |
| Molecular Weight | 683.21 g/mol |
| Exact Mass | 682.26 |
| IUPAC Name | methyl 6-[3-[3-[(3-chloro-4-phenylphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoylamino]propyl]-5-oxobenzo[c][2,6]naphthyridine-8-carboxylate |
| SMILES | COC(=O)c1ccc2c3cnccc3c(=O)n(CCCNC(=O)CCN(Cc3ccc(-c4ccccc4)c(Cl)c3)C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C38H39ClN4O6/c1-38(2,3)49-37(47)42(24-25-11-13-28(32(39)21-25)26-9-6-5-7-10-26)20-16-34(44)41-17-8-19-43-33-22-27(36(46)48-4)12-14-29(33)31-23-40-18-15-30(31)35(43)45/h5-7,9-15,18,21-23H,8,16-17,19-20,24H2,1-4H3,(H,41,44) |
| InChIKey | SESIMOBXADLOEI-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.21 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|