C23H23N3O4 — CID 155070258
tert-butyl N-[3-(5,11-dioxoindeno[1,2-c][2,6]naphthyridin-6-yl)propyl]carbamate (PubChem CID 155070258) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is tert-butyl N-[3-(5,11-dioxoindeno[1,2-c][2,6]naphthyridin-6-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(5,11-dioxoindeno[1,2-c][2,6]naphthyridin-6-yl)propyl]carbamate |
|---|---|
| PubChem CID | 155070258 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | tert-butyl N-[3-(5,11-dioxoindeno[1,2-c][2,6]naphthyridin-6-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCn1c2c(c3cnccc3c1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C23H23N3O4/c1-23(2,3)30-22(29)25-10-6-12-26-19-14-7-4-5-8-15(14)20(27)18(19)17-13-24-11-9-16(17)21(26)28/h4-5,7-9,11,13H,6,10,12H2,1-3H3,(H,25,29) |
| InChIKey | JMOGXTYMAZOBPN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|