C18H29N5O3 — CID 145044665
tert-butyl N-[3-(6-ethyl-4-oxo-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-5-yl)propyl]carbamate (PubChem CID 145044665) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is tert-butyl N-[3-(6-ethyl-4-oxo-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-5-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(6-ethyl-4-oxo-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-5-yl)propyl]carbamate |
|---|---|
| PubChem CID | 145044665 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | tert-butyl N-[3-(6-ethyl-4-oxo-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-5-yl)propyl]carbamate |
| SMILES | CCc1nc2c(cnn2C(C)C)c(=O)n1CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29N5O3/c1-7-14-21-15-13(11-20-23(15)12(2)3)16(24)22(14)10-8-9-19-17(25)26-18(4,5)6/h11-12H,7-10H2,1-6H3,(H,19,25) |
| InChIKey | MGJHTWJYOSSBHO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|